C23H25BrN2O2 — CID 157180055
tert-butyl (2S)-2-[4-(4-bromonaphthalen-1-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157180055) has the molecular formula C23H25BrN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(4-bromonaphthalen-1-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(4-bromonaphthalen-1-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157180055 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | tert-butyl (2S)-2-[4-(4-bromonaphthalen-1-yl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(Br)c3ccccc23)C1 |
| InChI | InChI=1S/C23H25BrN2O2/c1-23(2,3)28-22(27)26-12-6-9-21(26)20-13-15(14-25-20)16-10-11-19(24)18-8-5-4-7-17(16)18/h4-5,7-8,10-11,14,21H,6,9,12-13H2,1-3H3/t21-/m0/s1 |
| InChIKey | NHJKYIZCHDMASA-NRFANRHFSA-N |
| XLogP | 6.19 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |