C20H25BrN2O2 — CID 58490398
tert-butyl (2S)-2-[4-(4-bromo-3-methylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58490398) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(4-bromo-3-methylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(4-bromo-3-methylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58490398 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | tert-butyl (2S)-2-[4-(4-bromo-3-methylphenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C2=CN=C([C@@H]3CCCN3C(=O)OC(C)(C)C)C2)ccc1Br |
| InChI | InChI=1S/C20H25BrN2O2/c1-13-10-14(7-8-16(13)21)15-11-17(22-12-15)18-6-5-9-23(18)19(24)25-20(2,3)4/h7-8,10,12,18H,5-6,9,11H2,1-4H3/t18-/m0/s1 |
| InChIKey | QMJCKXSNBNBYPJ-SFHVURJKSA-N |
| XLogP | 5.34 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |