C19H22BrFN2O2 — CID 58490570
tert-butyl (2S)-2-[4-(4-bromo-2-fluorophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 58490570) has the molecular formula C19H22BrFN2O2 and a molecular weight of 409.30 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4-(4-bromo-2-fluorophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4-(4-bromo-2-fluorophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58490570 |
| Molecular Formula | C19H22BrFN2O2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | tert-butyl (2S)-2-[4-(4-bromo-2-fluorophenyl)-3H-pyrrol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC=C(c2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C19H22BrFN2O2/c1-19(2,3)25-18(24)23-8-4-5-17(23)16-9-12(11-22-16)14-7-6-13(20)10-15(14)21/h6-7,10-11,17H,4-5,8-9H2,1-3H3/t17-/m0/s1 |
| InChIKey | XFALJBNATIIOIZ-KRWDZBQOSA-N |
| XLogP | 5.17 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |