C22H25F5N4O4 — CID 157248254
tert-butyl N-[[1-(4-amino-2,5-difluorophenyl)pyrrolidin-3-yl]methyl]carbamate;1,2,4-trifluoro-5-nitrobenzene (PubChem CID 157248254) has the molecular formula C22H25F5N4O4 and a molecular weight of 504.46 g/mol. Its IUPAC name is tert-butyl N-[[1-(4-amino-2,5-difluorophenyl)pyrrolidin-3-yl]methyl]carbamate;1,2,4-trifluoro-5-nitrobenzene.
| Compound Name | tert-butyl N-[[1-(4-amino-2,5-difluorophenyl)pyrrolidin-3-yl]methyl]carbamate;1,2,4-trifluoro-5-nitrobenzene |
|---|---|
| PubChem CID | 157248254 |
| Molecular Formula | C22H25F5N4O4 |
| Molecular Weight | 504.46 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | tert-butyl N-[[1-(4-amino-2,5-difluorophenyl)pyrrolidin-3-yl]methyl]carbamate;1,2,4-trifluoro-5-nitrobenzene |
| SMILES | CC(C)(C)OC(=O)NCC1CCN(c2cc(F)c(N)cc2F)C1.O=[N+]([O-])c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H23F2N3O2.C6H2F3NO2/c1-16(2,3)23-15(22)20-8-10-4-5-21(9-10)14-7-11(17)13(19)6-12(14)18;7-3-1-5(9)6(10(11)12)2-4(3)8/h6-7,10H,4-5,8-9,19H2,1-3H3,(H,20,22);1-2H |
| InChIKey | AWAQIBUAFLLFCC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|