C24H22F5N3O3 — CID 157250697
2-[3-[(4S,6S)-2-amino-6-(1,1-difluoroethyl)-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-1-(5-but-2-ynoxy-2-pyridinyl)ethanone (PubChem CID 157250697) has the molecular formula C24H22F5N3O3 and a molecular weight of 495.45 g/mol. Its IUPAC name is 2-[3-[(4S,6S)-2-amino-6-(1,1-difluoroethyl)-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-1-(5-but-2-ynoxy-2-pyridinyl)ethanone.
| Compound Name | 2-[3-[(4S,6S)-2-amino-6-(1,1-difluoroethyl)-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-1-(5-but-2-ynoxy-2-pyridinyl)ethanone |
|---|---|
| PubChem CID | 157250697 |
| Molecular Formula | C24H22F5N3O3 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[3-[(4S,6S)-2-amino-6-(1,1-difluoroethyl)-4-(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4,5-difluorophenyl]-1-(5-but-2-ynoxy-2-pyridinyl)ethanone |
| SMILES | CC#CCOc1ccc(C(=O)Cc2cc(F)c(F)c([C@]3(CF)C[C@@H](C(C)(F)F)OC(N)=N3)c2)nc1 |
| InChI | InChI=1S/C24H22F5N3O3/c1-3-4-7-34-15-5-6-18(31-12-15)19(33)10-14-8-16(21(27)17(26)9-14)24(13-25)11-20(23(2,28)29)35-22(30)32-24/h5-6,8-9,12,20H,7,10-11,13H2,1-2H3,(H2,30,32)/t20-,24+/m0/s1 |
| InChIKey | GVUFCZLHGOPNRZ-GBXCKJPGSA-N |
| XLogP | 4.11 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|