C20H30F6N4O4S2+2 — CID 157252542
1-butyl-3-ethenylimidazol-1-ium;1-methyl-3-pentyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium (PubChem CID 157252542) has the molecular formula C20H30F6N4O4S2+2 and a molecular weight of 568.61 g/mol. Its IUPAC name is 1-butyl-3-ethenylimidazol-1-ium;1-methyl-3-pentyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium.
| Compound Name | 1-butyl-3-ethenylimidazol-1-ium;1-methyl-3-pentyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium |
|---|---|
| PubChem CID | 157252542 |
| Molecular Formula | C20H30F6N4O4S2+2 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | 1-butyl-3-ethenylimidazol-1-ium;1-methyl-3-pentyl-2,4-bis(trifluoromethylsulfonyl)imidazol-1-ium |
| SMILES | C=Cn1cc[n+](CCCC)c1.CCCCCn1c(S(=O)(=O)C(F)(F)F)c[n+](C)c1S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H15F6N2O4S2.C9H15N2/c1-3-4-5-6-19-8(24(20,21)10(12,13)14)7-18(2)9(19)25(22,23)11(15,16)17;1-3-5-6-11-8-7-10(4-2)9-11/h7H,3-6H2,1-2H3;4,7-9H,2-3,5-6H2,1H3/q2*+1 |
| InChIKey | AWMSRCDTGXSGKD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 85.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|