C31H27Cl4NO3 — CID 157252881
2,2-bis(4-chlorophenyl)-N-methylpropanamide;2,2-bis(4-chlorophenyl)propanoic acid (PubChem CID 157252881) has the molecular formula C31H27Cl4NO3 and a molecular weight of 603.37 g/mol. Its IUPAC name is 2,2-bis(4-chlorophenyl)-N-methylpropanamide;2,2-bis(4-chlorophenyl)propanoic acid.
| Compound Name | 2,2-bis(4-chlorophenyl)-N-methylpropanamide;2,2-bis(4-chlorophenyl)propanoic acid |
|---|---|
| PubChem CID | 157252881 |
| Molecular Formula | C31H27Cl4NO3 |
| Molecular Weight | 603.37 g/mol |
| Exact Mass | 601.07 |
| IUPAC Name | 2,2-bis(4-chlorophenyl)-N-methylpropanamide;2,2-bis(4-chlorophenyl)propanoic acid |
| SMILES | CC(C(=O)O)(c1ccc(Cl)cc1)c1ccc(Cl)cc1.CNC(=O)C(C)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO.C15H12Cl2O2/c1-16(15(20)19-2,11-3-7-13(17)8-4-11)12-5-9-14(18)10-6-12;1-15(14(18)19,10-2-6-12(16)7-3-10)11-4-8-13(17)9-5-11/h3-10H,1-2H3,(H,19,20);2-9H,1H3,(H,18,19) |
| InChIKey | AWNRIBNCIAJZMD-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.37 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |