C23H22N6O2 — CID 157254831
N-[4-[6-(azidomethyl)-3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl]-2-pyridinyl]acetamide (PubChem CID 157254831) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[4-[6-(azidomethyl)-3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[6-(azidomethyl)-3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 157254831 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[4-[6-(azidomethyl)-3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(-c2[nH]c3c(c2Cc2ccccc2)C(=O)CC(CN=[N+]=[N-])C3)ccn1 |
| InChI | InChI=1S/C23H22N6O2/c1-14(30)27-21-12-17(7-8-25-21)23-18(9-15-5-3-2-4-6-15)22-19(28-23)10-16(11-20(22)31)13-26-29-24/h2-8,12,16,28H,9-11,13H2,1H3,(H,25,27,30) |
| InChIKey | AWTNKEAXBODOOI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|