C26H28N4OS — CID 160873071
1-[4-(3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-3-cyclopentylthiourea (PubChem CID 160873071) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is 1-[4-(3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-3-cyclopentylthiourea.
| Compound Name | 1-[4-(3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-3-cyclopentylthiourea |
|---|---|
| PubChem CID | 160873071 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 1-[4-(3-benzyl-4-oxo-1,5,6,7-tetrahydroindol-2-yl)-2-pyridinyl]-3-cyclopentylthiourea |
| SMILES | O=C1CCCc2[nH]c(-c3ccnc(NC(=S)NC4CCCC4)c3)c(Cc3ccccc3)c21 |
| InChI | InChI=1S/C26H28N4OS/c31-22-12-6-11-21-24(22)20(15-17-7-2-1-3-8-17)25(29-21)18-13-14-27-23(16-18)30-26(32)28-19-9-4-5-10-19/h1-3,7-8,13-14,16,19,29H,4-6,9-12,15H2,(H2,27,28,30,32) |
| InChIKey | SMAAAZDVRHZIDN-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|