C39H40BrF3N6 — CID 157255670
1-[(6-bromo-3-pyridinyl)methyl]-3-phenylpiperazine;3-phenyl-1-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]piperazine (PubChem CID 157255670) has the molecular formula C39H40BrF3N6 and a molecular weight of 729.69 g/mol. Its IUPAC name is 1-[(6-bromo-3-pyridinyl)methyl]-3-phenylpiperazine;3-phenyl-1-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]piperazine.
| Compound Name | 1-[(6-bromo-3-pyridinyl)methyl]-3-phenylpiperazine;3-phenyl-1-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]piperazine |
|---|---|
| PubChem CID | 157255670 |
| Molecular Formula | C39H40BrF3N6 |
| Molecular Weight | 729.69 g/mol |
| Exact Mass | 728.24 |
| IUPAC Name | 1-[(6-bromo-3-pyridinyl)methyl]-3-phenylpiperazine;3-phenyl-1-[[6-[2-(trifluoromethyl)phenyl]-3-pyridinyl]methyl]piperazine |
| SMILES | Brc1ccc(CN2CCNC(c3ccccc3)C2)cn1.FC(F)(F)c1ccccc1-c1ccc(CN2CCNC(c3ccccc3)C2)cn1 |
| InChI | InChI=1S/C23H22F3N3.C16H18BrN3/c24-23(25,26)20-9-5-4-8-19(20)21-11-10-17(14-28-21)15-29-13-12-27-22(16-29)18-6-2-1-3-7-18;17-16-7-6-13(10-19-16)11-20-9-8-18-15(12-20)14-4-2-1-3-5-14/h1-11,14,22,27H,12-13,15-16H2;1-7,10,15,18H,8-9,11-12H2 |
| InChIKey | AWWCIDZXECCPLQ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|