C16H30O9 — CID 157258625
2-butoxyprop-2-enoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enoic acid (PubChem CID 157258625) has the molecular formula C16H30O9 and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-butoxyprop-2-enoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enoic acid.
| Compound Name | 2-butoxyprop-2-enoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 157258625 |
| Molecular Formula | C16H30O9 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-butoxyprop-2-enoic acid;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;prop-2-enoic acid |
| SMILES | C=C(OCCCC)C(=O)O.C=CC(=O)O.OCCOCCOCCO |
| InChI | InChI=1S/C7H12O3.C6H14O4.C3H4O2/c1-3-4-5-10-6(2)7(8)9;7-1-3-9-5-6-10-4-2-8;1-2-3(4)5/h2-5H2,1H3,(H,8,9);7-8H,1-6H2;2H,1H2,(H,4,5) |
| InChIKey | AXEOSDNBHYXTSA-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|