C27H24O8S2 — CID 157259971
2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonate;triphenylsulfanium (PubChem CID 157259971) has the molecular formula C27H24O8S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is 2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonate;triphenylsulfanium.
| Compound Name | 2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 157259971 |
| Molecular Formula | C27H24O8S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 2-oxo-2-[(5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethanesulfonate;triphenylsulfanium |
| SMILES | O=C(CS(=O)(=O)[O-])OC1C2CC3C(=O)OC1C3O2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H10O8S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-5(2-18(12,13)14)16-7-4-1-3-6(15-4)8(7)17-9(3)11/h1-15H;3-4,6-8H,1-2H2,(H,12,13,14)/q+1;/p-1 |
| InChIKey | AXIMBWVCKFXXMO-UHFFFAOYSA-M |
| XLogP | 2.94 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|