C32H30O10S2 — CID 157302403
2-[2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonate;triphenylsulfanium (PubChem CID 157302403) has the molecular formula C32H30O10S2 and a molecular weight of 638.72 g/mol. Its IUPAC name is 2-[2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonate;triphenylsulfanium.
| Compound Name | 2-[2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 157302403 |
| Molecular Formula | C32H30O10S2 |
| Molecular Weight | 638.72 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | 2-[2-(2-methylprop-2-enoyloxy)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonane-9-carbonyl]oxyethanesulfonate;triphenylsulfanium |
| SMILES | C=C(C)C(=O)OC1C2OC(=O)C3C2OC1C3C(=O)OCCS(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H16O10S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-5(2)12(15)23-10-8-6(13(16)21-3-4-25(18,19)20)7-9(22-8)11(10)24-14(7)17/h1-15H;6-11H,1,3-4H2,2H3,(H,18,19,20)/q+1;/p-1 |
| InChIKey | BCBBGDLTPGJMFC-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 145.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.72 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|