C25H25BBrFN4O5 — CID 157260538
5-bromo-1-[(5-fluoro-2-nitrophenyl)methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 157260538) has the molecular formula C25H25BBrFN4O5 and a molecular weight of 571.21 g/mol. Its IUPAC name is 5-bromo-1-[(5-fluoro-2-nitrophenyl)methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | 5-bromo-1-[(5-fluoro-2-nitrophenyl)methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 157260538 |
| Molecular Formula | C25H25BBrFN4O5 |
| Molecular Weight | 571.21 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | 5-bromo-1-[(5-fluoro-2-nitrophenyl)methyl]pyridin-2-one;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC1(C)OB(c2ccc3cn[nH]c3c2)OC1(C)C.O=c1ccc(Br)cn1Cc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17BN2O2.C12H8BrFN2O3/c1-12(2)13(3,4)18-14(17-12)10-6-5-9-8-15-16-11(9)7-10;13-9-1-4-12(17)15(7-9)6-8-5-10(14)2-3-11(8)16(18)19/h5-8H,1-4H3,(H,15,16);1-5,7H,6H2 |
| InChIKey | AXKAGGBGIWPBFR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.21 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|