C11H16ClF3N2O2 — CID 157267746
2-[2-chloro-4-(trifluoromethyl)pyrimidin-5-yl]propan-2-ol;propan-2-ol (PubChem CID 157267746) has the molecular formula C11H16ClF3N2O2 and a molecular weight of 300.71 g/mol. Its IUPAC name is 2-[2-chloro-4-(trifluoromethyl)pyrimidin-5-yl]propan-2-ol;propan-2-ol.
| Compound Name | 2-[2-chloro-4-(trifluoromethyl)pyrimidin-5-yl]propan-2-ol;propan-2-ol |
|---|---|
| PubChem CID | 157267746 |
| Molecular Formula | C11H16ClF3N2O2 |
| Molecular Weight | 300.71 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[2-chloro-4-(trifluoromethyl)pyrimidin-5-yl]propan-2-ol;propan-2-ol |
| SMILES | CC(C)(O)c1cnc(Cl)nc1C(F)(F)F.CC(C)O |
| InChI | InChI=1S/C8H8ClF3N2O.C3H8O/c1-7(2,15)4-3-13-6(9)14-5(4)8(10,11)12;1-3(2)4/h3,15H,1-2H3;3-4H,1-2H3 |
| InChIKey | AYEMZSIBBUUOPN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.71 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |