C14H8ClF4N3S — CID 163214404
3-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]-6-fluoro-7-methylsulfanyl-1H-indole (PubChem CID 163214404) has the molecular formula C14H8ClF4N3S and a molecular weight of 361.75 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]-6-fluoro-7-methylsulfanyl-1H-indole.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]-6-fluoro-7-methylsulfanyl-1H-indole |
|---|---|
| PubChem CID | 163214404 |
| Molecular Formula | C14H8ClF4N3S |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]-6-fluoro-7-methylsulfanyl-1H-indole |
| SMILES | CSc1c(F)ccc2c(-c3nc(Cl)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C14H8ClF4N3S/c1-23-12-9(16)3-2-6-7(4-20-11(6)12)10-8(14(17,18)19)5-21-13(15)22-10/h2-5,20H,1H3 |
| InChIKey | RPXTWYYEYGFKEC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |