C16H14F3N4O3P — CID 170129730
3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-7-dimethylphosphoryl-1H-indole-6-carboxylic acid (PubChem CID 170129730) has the molecular formula C16H14F3N4O3P and a molecular weight of 398.28 g/mol. Its IUPAC name is 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-7-dimethylphosphoryl-1H-indole-6-carboxylic acid.
| Compound Name | 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-7-dimethylphosphoryl-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 170129730 |
| Molecular Formula | C16H14F3N4O3P |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-7-dimethylphosphoryl-1H-indole-6-carboxylic acid |
| SMILES | CP(C)(=O)c1c(C(=O)O)ccc2c(-c3nc(N)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C16H14F3N4O3P/c1-27(2,26)13-8(14(24)25)4-3-7-9(5-21-12(7)13)11-10(16(17,18)19)6-22-15(20)23-11/h3-6,21H,1-2H3,(H,24,25)(H2,20,22,23) |
| InChIKey | CNYIOVDFIDFJCC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|