C27H34F3N6O2P — CID 176511186
28-dimethylphosphoryl-17-methyl-6-(trifluoromethyl)-2,4,10,17,22,29-hexazapentacyclo[20.4.1.13,7.111,15.08,12]nonacosa-3,5,7(29),8,11,13,15(28)-heptaen-16-one (PubChem CID 176511186) has the molecular formula C27H34F3N6O2P and a molecular weight of 562.58 g/mol. Its IUPAC name is 28-dimethylphosphoryl-17-methyl-6-(trifluoromethyl)-2,4,10,17,22,29-hexazapentacyclo[20.4.1.13,7.111,15.08,12]nonacosa-3,5,7(29),8,11,13,15(28)-heptaen-16-one.
| Compound Name | 28-dimethylphosphoryl-17-methyl-6-(trifluoromethyl)-2,4,10,17,22,29-hexazapentacyclo[20.4.1.13,7.111,15.08,12]nonacosa-3,5,7(29),8,11,13,15(28)-heptaen-16-one |
|---|---|
| PubChem CID | 176511186 |
| Molecular Formula | C27H34F3N6O2P |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 28-dimethylphosphoryl-17-methyl-6-(trifluoromethyl)-2,4,10,17,22,29-hexazapentacyclo[20.4.1.13,7.111,15.08,12]nonacosa-3,5,7(29),8,11,13,15(28)-heptaen-16-one |
| SMILES | CN1CCCCN2CCCCC(C2)Nc2ncc(C(F)(F)F)c(n2)-c2c[nH]c3c(P(C)(C)=O)c(ccc23)C1=O |
| InChI | InChI=1S/C27H34F3N6O2P/c1-35-11-6-7-13-36-12-5-4-8-17(16-36)33-26-32-15-21(27(28,29)30)22(34-26)20-14-31-23-18(20)9-10-19(25(35)37)24(23)39(2,3)38/h9-10,14-15,17,31H,4-8,11-13,16H2,1-3H3,(H,32,33,34) |
| InChIKey | AXPPFAXICUWCCP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|