C25H29F4N6O2P — CID 170129350
(17S,20S)-28-dimethylphosphoryl-14-fluoro-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one (PubChem CID 170129350) has the molecular formula C25H29F4N6O2P and a molecular weight of 552.51 g/mol. Its IUPAC name is (17S,20S)-28-dimethylphosphoryl-14-fluoro-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one.
| Compound Name | (17S,20S)-28-dimethylphosphoryl-14-fluoro-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one |
|---|---|
| PubChem CID | 170129350 |
| Molecular Formula | C25H29F4N6O2P |
| Molecular Weight | 552.51 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | (17S,20S)-28-dimethylphosphoryl-14-fluoro-25-(trifluoromethyl)-4,11,16,21,23,26-hexazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaen-10-one |
| SMILES | CP(C)(=O)c1c2ccc3c(c[nH]c13)-c1nc(ncc1C(F)(F)F)N[C@H]1CC[C@@H](C1)NCC(F)CCNC2=O |
| InChI | InChI=1S/C25H29F4N6O2P/c1-38(2,37)22-17-6-5-16-18(11-32-21(16)22)20-19(25(27,28)29)12-33-24(35-20)34-15-4-3-14(9-15)31-10-13(26)7-8-30-23(17)36/h5-6,11-15,31-32H,3-4,7-10H2,1-2H3,(H,30,36)(H,33,34,35)/t13?,14-,15-/m0/s1 |
| InChIKey | VECLQDFDOOFJLN-FGRDXJNISA-N |
| XLogP | 4.29 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|