C19H20F3N4O3P — CID 167145218
(3R,4S)-4-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-ol (PubChem CID 167145218) has the molecular formula C19H20F3N4O3P and a molecular weight of 440.36 g/mol. Its IUPAC name is (3R,4S)-4-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-ol.
| Compound Name | (3R,4S)-4-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-ol |
|---|---|
| PubChem CID | 167145218 |
| Molecular Formula | C19H20F3N4O3P |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (3R,4S)-4-[[4-(7-dimethylphosphoryl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]oxolan-3-ol |
| SMILES | CP(C)(=O)c1cccc2c(-c3nc(N[C@H]4COC[C@@H]4O)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C19H20F3N4O3P/c1-30(2,28)15-5-3-4-10-11(6-23-17(10)15)16-12(19(20,21)22)7-24-18(26-16)25-13-8-29-9-14(13)27/h3-7,13-14,23,27H,8-9H2,1-2H3,(H,24,25,26)/t13-,14-/m0/s1 |
| InChIKey | IKZWWVPVQQASIQ-KBPBESRZSA-N |
| XLogP | 3.06 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|