C18H20F3N4O2P — CID 167145484
2-[[4-(7-dimethylphosphanyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propane-1,3-diol (PubChem CID 167145484) has the molecular formula C18H20F3N4O2P and a molecular weight of 412.35 g/mol. Its IUPAC name is 2-[[4-(7-dimethylphosphanyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[4-(7-dimethylphosphanyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 167145484 |
| Molecular Formula | C18H20F3N4O2P |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 2-[[4-(7-dimethylphosphanyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propane-1,3-diol |
| SMILES | CP(C)c1cccc2c(-c3nc(NC(CO)CO)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C18H20F3N4O2P/c1-28(2)14-5-3-4-11-12(6-22-16(11)14)15-13(18(19,20)21)7-23-17(25-15)24-10(8-26)9-27/h3-7,10,22,26-27H,8-9H2,1-2H3,(H,23,24,25) |
| InChIKey | XLOWQLRGDDTEPT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|