C16H11F6N4O2P — CID 175462022
1,1,3-trifluoro-3-[[4-(7-phosphoroso-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-2-ol (PubChem CID 175462022) has the molecular formula C16H11F6N4O2P and a molecular weight of 436.25 g/mol. Its IUPAC name is 1,1,3-trifluoro-3-[[4-(7-phosphoroso-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-2-ol.
| Compound Name | 1,1,3-trifluoro-3-[[4-(7-phosphoroso-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-2-ol |
|---|---|
| PubChem CID | 175462022 |
| Molecular Formula | C16H11F6N4O2P |
| Molecular Weight | 436.25 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1,1,3-trifluoro-3-[[4-(7-phosphoroso-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]amino]propan-2-ol |
| SMILES | O=Pc1cccc2c(-c3nc(NC(F)C(O)C(F)F)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C16H11F6N4O2P/c17-13(18)12(27)14(19)26-15-24-5-8(16(20,21)22)10(25-15)7-4-23-11-6(7)2-1-3-9(11)29-28/h1-5,12-14,23,27H,(H,24,25,26) |
| InChIKey | IFSQKDYLNVIJKN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.25 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|