C14H10F3N4OPS — CID 170358098
N-[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]-7-phosphoroso-1H-indol-3-amine (PubChem CID 170358098) has the molecular formula C14H10F3N4OPS and a molecular weight of 370.30 g/mol. Its IUPAC name is N-[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]-7-phosphoroso-1H-indol-3-amine.
| Compound Name | N-[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]-7-phosphoroso-1H-indol-3-amine |
|---|---|
| PubChem CID | 170358098 |
| Molecular Formula | C14H10F3N4OPS |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-[2-methylsulfanyl-5-(trifluoromethyl)pyrimidin-4-yl]-7-phosphoroso-1H-indol-3-amine |
| SMILES | CSc1ncc(C(F)(F)F)c(Nc2c[nH]c3c(P=O)cccc23)n1 |
| InChI | InChI=1S/C14H10F3N4OPS/c1-24-13-19-5-8(14(15,16)17)12(21-13)20-9-6-18-11-7(9)3-2-4-10(11)23-22/h2-6,18H,1H3,(H,19,20,21) |
| InChIKey | VVFDHXWBVWHAJX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|