C24H22F5N7O2 — CID 166477358
4-N-[2-(dimethylamino)ethyl]-2-fluoro-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 166477358) has the molecular formula C24H22F5N7O2 and a molecular weight of 535.48 g/mol. Its IUPAC name is 4-N-[2-(dimethylamino)ethyl]-2-fluoro-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 4-N-[2-(dimethylamino)ethyl]-2-fluoro-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 166477358 |
| Molecular Formula | C24H22F5N7O2 |
| Molecular Weight | 535.48 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-N-[2-(dimethylamino)ethyl]-2-fluoro-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | CN(C)CCN(C)c1cc(F)c(Nc2ncc(C(F)(F)F)c(-c3c[nH]c4c(F)cccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H22F5N7O2/c1-34(2)7-8-35(3)19-9-17(26)18(10-20(19)36(37)38)32-23-31-12-15(24(27,28)29)21(33-23)14-11-30-22-13(14)5-4-6-16(22)25/h4-6,9-12,30H,7-8H2,1-3H3,(H,31,32,33) |
| InChIKey | OSFAQRBNBODOJD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 103.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|