C25H25F4N7 — CID 166477724
4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 166477724) has the molecular formula C25H25F4N7 and a molecular weight of 499.52 g/mol. Its IUPAC name is 4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 166477724 |
| Molecular Formula | C25H25F4N7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-1-N-[4-(7-fluoro-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | CN(C)[C@@H]1CCN(c2ccc(Nc3ncc(C(F)(F)F)c(-c4c[nH]c5c(F)cccc45)n3)cc2N)C1 |
| InChI | InChI=1S/C25H25F4N7/c1-35(2)15-8-9-36(13-15)21-7-6-14(10-20(21)30)33-24-32-12-18(25(27,28)29)22(34-24)17-11-31-23-16(17)4-3-5-19(23)26/h3-7,10-12,15,31H,8-9,13,30H2,1-2H3,(H,32,33,34)/t15-/m1/s1 |
| InChIKey | HNHGKPAQVUXZPV-OAHLLOKOSA-N |
| XLogP | 5.25 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|