C26H30F3N7 — CID 166477521
1-N-[2-(dimethylamino)ethyl]-1-N-ethyl-4-N-[4-(1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 166477521) has the molecular formula C26H30F3N7 and a molecular weight of 497.57 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-1-N-ethyl-4-N-[4-(1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-1-N-ethyl-4-N-[4-(1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 166477521 |
| Molecular Formula | C26H30F3N7 |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-1-N-ethyl-4-N-[4-(1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | CCN(CCN(C)C)c1ccc(Nc2ncc(C(F)(F)F)c(-c3cn(C)c4ccccc34)n2)cc1N |
| InChI | InChI=1S/C26H30F3N7/c1-5-36(13-12-34(2)3)23-11-10-17(14-21(23)30)32-25-31-15-20(26(27,28)29)24(33-25)19-16-35(4)22-9-7-6-8-18(19)22/h6-11,14-16H,5,12-13,30H2,1-4H3,(H,31,32,33) |
| InChIKey | PIALKFQLLNGSKD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|