C22H27F3N8 — CID 151481328
4-N-[2-(3-aminoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]-1-N-[2-(dimethylamino)ethyl]-1-N-methylbenzene-1,2,4-triamine (PubChem CID 151481328) has the molecular formula C22H27F3N8 and a molecular weight of 460.51 g/mol. Its IUPAC name is 4-N-[2-(3-aminoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]-1-N-[2-(dimethylamino)ethyl]-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 4-N-[2-(3-aminoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]-1-N-[2-(dimethylamino)ethyl]-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 151481328 |
| Molecular Formula | C22H27F3N8 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 4-N-[2-(3-aminoanilino)-5-(trifluoromethyl)pyrimidin-4-yl]-1-N-[2-(dimethylamino)ethyl]-1-N-methylbenzene-1,2,4-triamine |
| SMILES | CN(C)CCN(C)c1ccc(Nc2nc(Nc3cccc(N)c3)ncc2C(F)(F)F)cc1N |
| InChI | InChI=1S/C22H27F3N8/c1-32(2)9-10-33(3)19-8-7-16(12-18(19)27)29-20-17(22(23,24)25)13-28-21(31-20)30-15-6-4-5-14(26)11-15/h4-8,11-13H,9-10,26-27H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | PMNKSFWOSMESGV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|