C21H19F3N5O4- — CID 163459910
3-[[2-[3-[(2-ethoxy-2-oxoethyl)-hydroxyamino]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenolate (PubChem CID 163459910) has the molecular formula C21H19F3N5O4- and a molecular weight of 462.41 g/mol. Its IUPAC name is 3-[[2-[3-[(2-ethoxy-2-oxoethyl)-hydroxyamino]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenolate.
| Compound Name | 3-[[2-[3-[(2-ethoxy-2-oxoethyl)-hydroxyamino]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenolate |
|---|---|
| PubChem CID | 163459910 |
| Molecular Formula | C21H19F3N5O4- |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-[[2-[3-[(2-ethoxy-2-oxoethyl)-hydroxyamino]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenolate |
| SMILES | CCOC(=O)CN(O)c1cccc(Nc2ncc(C(F)(F)F)c(Nc3cccc([O-])c3)n2)c1 |
| InChI | InChI=1S/C21H20F3N5O4/c1-2-33-18(31)12-29(32)15-7-3-5-13(9-15)27-20-25-11-17(21(22,23)24)19(28-20)26-14-6-4-8-16(30)10-14/h3-11,30,32H,2,12H2,1H3,(H2,25,26,27,28)/p-1 |
| InChIKey | CRXBABIZEHKBHN-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|