C26H29FN8 — CID 166477519
1-N-[2-(dimethylamino)ethyl]-4-N-[5-fluoro-4-(1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-1-N-methylbenzene-1,2,4-triamine (PubChem CID 166477519) has the molecular formula C26H29FN8 and a molecular weight of 472.57 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-4-N-[5-fluoro-4-(1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[5-fluoro-4-(1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 166477519 |
| Molecular Formula | C26H29FN8 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[5-fluoro-4-(1-methylindol-3-yl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]-1-N-methylbenzene-1,2,4-triamine |
| SMILES | CN(C)CCN(C)c1ccc(Nc2nc(-c3cn(C)c4ccccc34)c3c(F)c[nH]c3n2)cc1N |
| InChI | InChI=1S/C26H29FN8/c1-33(2)11-12-34(3)22-10-9-16(13-20(22)28)30-26-31-24(23-19(27)14-29-25(23)32-26)18-15-35(4)21-8-6-5-7-17(18)21/h5-10,13-15H,11-12,28H2,1-4H3,(H2,29,30,31,32) |
| InChIKey | FHFHCJFFBXZEJP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 91.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|