C20H16F3N5 — CID 175569427
2-[4-(7-methyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine (PubChem CID 175569427) has the molecular formula C20H16F3N5 and a molecular weight of 383.38 g/mol. Its IUPAC name is 2-[4-(7-methyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine.
| Compound Name | 2-[4-(7-methyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 175569427 |
| Molecular Formula | C20H16F3N5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[4-(7-methyl-1H-indol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,3-diamine |
| SMILES | Cc1cccc2c(-c3nc(-c4c(N)cccc4N)ncc3C(F)(F)F)c[nH]c12 |
| InChI | InChI=1S/C20H16F3N5/c1-10-4-2-5-11-12(8-26-17(10)11)18-13(20(21,22)23)9-27-19(28-18)16-14(24)6-3-7-15(16)25/h2-9,26H,24-25H2,1H3 |
| InChIKey | GWKASZPQIXSHOF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|