C20H20N6O — CID 175569424
3-[5-methoxy-4-(7-methyl-1H-indol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 175569424) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 3-[5-methoxy-4-(7-methyl-1H-indol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 3-[5-methoxy-4-(7-methyl-1H-indol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 175569424 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-[5-methoxy-4-(7-methyl-1H-indol-3-yl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | COc1cnc(-c2c(N)ccc(N)c2N)nc1-c1c[nH]c2c(C)cccc12 |
| InChI | InChI=1S/C20H20N6O/c1-10-4-3-5-11-12(8-24-18(10)11)19-15(27-2)9-25-20(26-19)16-13(21)6-7-14(22)17(16)23/h3-9,24H,21-23H2,1-2H3 |
| InChIKey | JZRFJWWQKBTVOH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 128.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|