C20H16F4N6 — CID 175569382
3-[4-(7-fluoro-1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine (PubChem CID 175569382) has the molecular formula C20H16F4N6 and a molecular weight of 416.38 g/mol. Its IUPAC name is 3-[4-(7-fluoro-1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine.
| Compound Name | 3-[4-(7-fluoro-1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 175569382 |
| Molecular Formula | C20H16F4N6 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 3-[4-(7-fluoro-1-methylindol-3-yl)-5-(trifluoromethyl)pyrimidin-2-yl]benzene-1,2,4-triamine |
| SMILES | Cn1cc(-c2nc(-c3c(N)ccc(N)c3N)ncc2C(F)(F)F)c2cccc(F)c21 |
| InChI | InChI=1S/C20H16F4N6/c1-30-8-10(9-3-2-4-12(21)18(9)30)17-11(20(22,23)24)7-28-19(29-17)15-13(25)5-6-14(26)16(15)27/h2-8H,25-27H2,1H3 |
| InChIKey | UWSFYONYVCDYIY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|