C16H14F4N3OP — CID 167145462
[3-[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-1H-indol-7-yl]-dimethylphosphane (PubChem CID 167145462) has the molecular formula C16H14F4N3OP and a molecular weight of 371.27 g/mol. Its IUPAC name is [3-[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-1H-indol-7-yl]-dimethylphosphane.
| Compound Name | [3-[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-1H-indol-7-yl]-dimethylphosphane |
|---|---|
| PubChem CID | 167145462 |
| Molecular Formula | C16H14F4N3OP |
| Molecular Weight | 371.27 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | [3-[5-fluoro-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-1H-indol-7-yl]-dimethylphosphane |
| SMILES | CP(C)c1cccc2c(-c3nc(OCC(F)(F)F)ncc3F)c[nH]c12 |
| InChI | InChI=1S/C16H14F4N3OP/c1-25(2)12-5-3-4-9-10(6-21-14(9)12)13-11(17)7-22-15(23-13)24-8-16(18,19)20/h3-7,21H,8H2,1-2H3 |
| InChIKey | ALBPPOVTXIYRHN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|