C26H33F3N5O2P — CID 176737650
(17S,20S)-28-dimethylphosphoryl-10-methyl-25-(trifluoromethyl)-13-oxa-4,16,21,23,26-pentazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaene (PubChem CID 176737650) has the molecular formula C26H33F3N5O2P and a molecular weight of 535.55 g/mol. Its IUPAC name is (17S,20S)-28-dimethylphosphoryl-10-methyl-25-(trifluoromethyl)-13-oxa-4,16,21,23,26-pentazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaene.
| Compound Name | (17S,20S)-28-dimethylphosphoryl-10-methyl-25-(trifluoromethyl)-13-oxa-4,16,21,23,26-pentazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaene |
|---|---|
| PubChem CID | 176737650 |
| Molecular Formula | C26H33F3N5O2P |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | (17S,20S)-28-dimethylphosphoryl-10-methyl-25-(trifluoromethyl)-13-oxa-4,16,21,23,26-pentazapentacyclo[20.3.1.15,9.117,20.02,6]octacosa-1(26),2,5,7,9(28),22,24-heptaene |
| SMILES | CC1CCOCCN[C@H]2CC[C@@H](C2)Nc2ncc(C(F)(F)F)c(n2)-c2c[nH]c3c(P(C)(C)=O)c1ccc23 |
| InChI | InChI=1S/C26H33F3N5O2P/c1-15-8-10-36-11-9-30-16-4-5-17(12-16)33-25-32-14-21(26(27,28)29)22(34-25)20-13-31-23-19(20)7-6-18(15)24(23)37(2,3)35/h6-7,13-17,30-31H,4-5,8-12H2,1-3H3,(H,32,33,34)/t15?,16-,17-/m0/s1 |
| InChIKey | XUMTXVGPXFTMGY-BSOSBYQFSA-N |
| XLogP | 5.34 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|