C15H11F3N4O2 — CID 170129473
methyl 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole-6-carboxylate (PubChem CID 170129473) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is methyl 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 170129473 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | methyl 3-[2-amino-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(-c3nc(N)ncc3C(F)(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C15H11F3N4O2/c1-24-13(23)7-2-3-8-9(5-20-11(8)4-7)12-10(15(16,17)18)6-21-14(19)22-12/h2-6,20H,1H3,(H2,19,21,22) |
| InChIKey | JVYQONNCFIIRQE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |