About 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine
4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine (PubChem CID 157268585) has the molecular formula C25H53N3O
and a molecular weight of 411.72 g/mol. Its IUPAC name is 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine.
Molecular Properties
| Compound Name | 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine |
| PubChem CID | 157268585 |
| Molecular Formula | C25H53N3O |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 411.42 |
| IUPAC Name | 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine |
| SMILES | CC(C)(C)N1CCCC1.CC(C)(C)N1CCCCC1.CC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C9H19N.C8H17NO.C8H17N/c1-9(2,3)10-7-5-4-6-8-10;1-8(2,3)9-4-6-10-7-5-9;1-8(2,3)9-6-4-5-7-9/h4-8H2,1-3H3;4-7H2,1-3H3;4-7H2,1-3H3 |
| InChIKey | AYGUBOWUINNWME-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The IUPAC name of 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine (CID 157268585) is 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine.
What is the SMILES notation for 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The canonical SMILES for 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine is CC(C)(C)N1CCCC1.CC(C)(C)N1CCCCC1.CC(C)(C)N1CCOCC1.
What is the InChIKey of 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
The InChIKey is AYGUBOWUINNWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H17NO.C8H17N/c1-9(2,3)10-7-5-4-6-8-10;1-8(2,3)9-4-6-10-7-5-9;1-8(2,3)9-6-4-5-7-9/h4-8H2,1-3H3;4-7H2,1-3H3;4-7H2,1-3H3.
What are the key properties of 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine?
4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine has a molecular weight of 411.72 g/mol, XLogP of 5.27, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butylmorpholine;1-tert-butylpiperidine;1-tert-butylpyrrolidine is sourced from PubChem (CID 157268585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).