C12H10N3O2+ — CID 157268958
6-[(3-ethynylpyridin-1-ium-1-yl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 157268958) has the molecular formula C12H10N3O2+ and a molecular weight of 228.23 g/mol. Its IUPAC name is 6-[(3-ethynylpyridin-1-ium-1-yl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[(3-ethynylpyridin-1-ium-1-yl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 157268958 |
| Molecular Formula | C12H10N3O2+ |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 6-[(3-ethynylpyridin-1-ium-1-yl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | C#Cc1ccc[n+](Cc2cc(=O)[nH]c(=O)[nH]2)c1 |
| InChI | InChI=1S/C12H9N3O2/c1-2-9-4-3-5-15(7-9)8-10-6-11(16)14-12(17)13-10/h1,3-7H,8H2,(H-,13,14,16,17)/p+1 |
| InChIKey | OQTFYTMTNZMGAH-UHFFFAOYSA-O |
| XLogP | -0.62 |
| TPSA | 69.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|