C12H11N3O3 — CID 2826306
1-acetyl-3-(pyridin-3-ylmethylidene)piperazine-2,5-dione (PubChem CID 2826306) has the molecular formula C12H11N3O3 and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-acetyl-3-(pyridin-3-ylmethylidene)piperazine-2,5-dione.
| Compound Name | 1-acetyl-3-(pyridin-3-ylmethylidene)piperazine-2,5-dione |
|---|---|
| PubChem CID | 2826306 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 1-acetyl-3-(pyridin-3-ylmethylidene)piperazine-2,5-dione |
| SMILES | CC(=O)N1CC(=O)NC(=Cc2cccnc2)C1=O |
| InChI | InChI=1S/C12H11N3O3/c1-8(16)15-7-11(17)14-10(12(15)18)5-9-3-2-4-13-6-9/h2-6H,7H2,1H3,(H,14,17) |
| InChIKey | NJDPZKFXNDIJSY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|