C21H22N6O4S2 — CID 157269587
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-nitrophenyl)-1,3-thiazole-2-carboxamide;1,3-thiazole-2-carboxamide (PubChem CID 157269587) has the molecular formula C21H22N6O4S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-nitrophenyl)-1,3-thiazole-2-carboxamide;1,3-thiazole-2-carboxamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-nitrophenyl)-1,3-thiazole-2-carboxamide;1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 157269587 |
| Molecular Formula | C21H22N6O4S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-5-(4-nitrophenyl)-1,3-thiazole-2-carboxamide;1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nccs1.O=C(N[C@H]1CN2CCC1CC2)c1ncc(-c2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C17H18N4O3S.C4H4N2OS/c22-16(19-14-10-20-7-5-11(14)6-8-20)17-18-9-15(25-17)12-1-3-13(4-2-12)21(23)24;5-3(7)4-6-1-2-8-4/h1-4,9,11,14H,5-8,10H2,(H,19,22);1-2H,(H2,5,7)/t14-;/m0./s1 |
| InChIKey | AYJNRCJPWWVOBR-UQKRIMTDSA-N |
| XLogP | 2.78 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|