C58H38BBr2ClN6O2 — CID 157270205
(3-bromophenyl)boronic acid;2-(3-bromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine;2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine (PubChem CID 157270205) has the molecular formula C58H38BBr2ClN6O2 and a molecular weight of 1057.06 g/mol. Its IUPAC name is (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine;2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine.
| Compound Name | (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine;2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 157270205 |
| Molecular Formula | C58H38BBr2ClN6O2 |
| Molecular Weight | 1057.06 g/mol |
| Exact Mass | 1054.12 |
| IUPAC Name | (3-bromophenyl)boronic acid;2-(3-bromophenyl)-4,6-dinaphthalen-1-yl-1,3,5-triazine;2-chloro-4,6-dinaphthalen-1-yl-1,3,5-triazine |
| SMILES | Brc1cccc(-c2nc(-c3cccc4ccccc34)nc(-c3cccc4ccccc34)n2)c1.Clc1nc(-c2cccc3ccccc23)nc(-c2cccc3ccccc23)n1.OB(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C29H18BrN3.C23H14ClN3.C6H6BBrO2/c30-22-13-5-12-21(18-22)27-31-28(25-16-6-10-19-8-1-3-14-23(19)25)33-29(32-27)26-17-7-11-20-9-2-4-15-24(20)26;24-23-26-21(19-13-5-9-15-7-1-3-11-17(15)19)25-22(27-23)20-14-6-10-16-8-2-4-12-18(16)20;8-6-3-1-2-5(4-6)7(9)10/h1-18H;1-14H;1-4,9-10H |
| InChIKey | AYLFVRCPGCTVGS-UHFFFAOYSA-N |
| XLogP | 14.24 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.06 |
| LogP ≤ 5 | 14.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|