About 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate
1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate (PubChem CID 157271805) has the molecular formula C22H21BrF2N2O4
and a molecular weight of 495.32 g/mol. Its IUPAC name is 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate.
Molecular Properties
| Compound Name | 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate |
| PubChem CID | 157271805 |
| Molecular Formula | C22H21BrF2N2O4 |
| Molecular Weight | 495.32 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate |
| SMILES | Fc1cccc(Br)c1.[C-]#[N+]C(C(=O)OCC)c1cccc(F)c1.[C-]#[N+]CC(=O)OCC |
| InChI | InChI=1S/C11H10FNO2.C6H4BrF.C5H7NO2/c1-3-15-11(14)10(13-2)8-5-4-6-9(12)7-8;7-5-2-1-3-6(8)4-5;1-3-8-5(7)4-6-2/h4-7,10H,3H2,1H3;1-4H;3-4H2,1H3 |
| InChIKey | AYPXVSFQVPWGAB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 61.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 495.32 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate?
The IUPAC name of 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate (CID 157271805) is 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate.
What is the SMILES notation for 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate?
The canonical SMILES for 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate is Fc1cccc(Br)c1.[C-]#[N+]C(C(=O)OCC)c1cccc(F)c1.[C-]#[N+]CC(=O)OCC.
What is the InChIKey of 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate?
The InChIKey is AYPXVSFQVPWGAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2.C6H4BrF.C5H7NO2/c1-3-15-11(14)10(13-2)8-5-4-6-9(12)7-8;7-5-2-1-3-6(8)4-5;1-3-8-5(7)4-6-2/h4-7,10H,3H2,1H3;1-4H;3-4H2,1H3.
What are the key properties of 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate?
1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate has a molecular weight of 495.32 g/mol, XLogP of 5.41, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-fluorobenzene;ethyl 2-(3-fluorophenyl)-2-isocyanoacetate;ethyl 2-isocyanoacetate is sourced from PubChem (CID 157271805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).