C26H23ClF2N4O2 — CID 157272240
N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide (PubChem CID 157272240) has the molecular formula C26H23ClF2N4O2 and a molecular weight of 496.95 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 157272240 |
| Molecular Formula | C26H23ClF2N4O2 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-4,5-difluoro-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2cc(F)c(F)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C26H23ClF2N4O2/c27-19-8-9-24(31-15-19)32-26(35)20-14-22(29)21(28)12-18(20)13-23(34)16-4-6-17(7-5-16)25(30)33-10-2-1-3-11-33/h4-9,12,14-15,30H,1-3,10-11,13H2,(H,31,32,35)/b30-25- |
| InChIKey | AYRDUTJQOGVYMY-JVCXMKTPSA-N |
| XLogP | 5.50 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|