C18H20O10 — CID 157274582
bis[1-(5-methyl-2-oxo-1,3-dioxol-4-yl)ethyl] hex-3-enedioate (PubChem CID 157274582) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is bis[1-(5-methyl-2-oxo-1,3-dioxol-4-yl)ethyl] hex-3-enedioate.
| Compound Name | bis[1-(5-methyl-2-oxo-1,3-dioxol-4-yl)ethyl] hex-3-enedioate |
|---|---|
| PubChem CID | 157274582 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | bis[1-(5-methyl-2-oxo-1,3-dioxol-4-yl)ethyl] hex-3-enedioate |
| SMILES | Cc1oc(=O)oc1C(C)OC(=O)CC=CCC(=O)OC(C)c1oc(=O)oc1C |
| InChI | InChI=1S/C18H20O10/c1-9(15-11(3)25-17(21)27-15)23-13(19)7-5-6-8-14(20)24-10(2)16-12(4)26-18(22)28-16/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | AYYDJHVHQHBAOA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 139.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|