C22H21O10P3+2 — CID 157274967
hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;2-methyl-1-[10-(2-methylprop-2-enoyl)anthracen-9-yl]prop-2-en-1-one (PubChem CID 157274967) has the molecular formula C22H21O10P3+2 and a molecular weight of 538.32 g/mol. Its IUPAC name is hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;2-methyl-1-[10-(2-methylprop-2-enoyl)anthracen-9-yl]prop-2-en-1-one.
| Compound Name | hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;2-methyl-1-[10-(2-methylprop-2-enoyl)anthracen-9-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 157274967 |
| Molecular Formula | C22H21O10P3+2 |
| Molecular Weight | 538.32 g/mol |
| Exact Mass | 538.03 |
| IUPAC Name | hydroxy-[hydroxy-[hydroxy(oxo)phosphaniumyl]oxyphosphoryl]oxy-oxophosphanium;2-methyl-1-[10-(2-methylprop-2-enoyl)anthracen-9-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)c1c2ccccc2c(C(=O)C(=C)C)c2ccccc12.O=[P+](O)OP(=O)(O)O[P+](=O)O |
| InChI | InChI=1S/C22H18O2.HO8P3/c1-13(2)21(23)19-15-9-5-7-11-17(15)20(22(24)14(3)4)18-12-8-6-10-16(18)19;1-9(2)7-11(5,6)8-10(3)4/h5-12H,1,3H2,2,4H3;(H-2,1,2,3,4,5,6)/p+2 |
| InChIKey | KGHDRGCCNACDKE-UHFFFAOYSA-P |
| XLogP | 5.93 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.32 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|