About 14-methylpentadecyl pentanoate
14-methylpentadecyl pentanoate (PubChem CID 157275601) has the molecular formula C21H42O2
and a molecular weight of 326.57 g/mol. Its IUPAC name is 14-methylpentadecyl pentanoate.
Molecular Properties
| Compound Name | 14-methylpentadecyl pentanoate |
| PubChem CID | 157275601 |
| Molecular Formula | C21H42O2 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.32 |
| IUPAC Name | 14-methylpentadecyl pentanoate |
| SMILES | CCCCC(=O)OCCCCCCCCCCCCCC(C)C |
| InChI | InChI=1S/C21H42O2/c1-4-5-18-21(22)23-19-16-14-12-10-8-6-7-9-11-13-15-17-20(2)3/h20H,4-19H2,1-3H3 |
| InChIKey | AZBDOGMKZHPRBD-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 14-methylpentadecyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14-methylpentadecyl pentanoate?
The IUPAC name of 14-methylpentadecyl pentanoate (CID 157275601) is 14-methylpentadecyl pentanoate.
What is the SMILES notation for 14-methylpentadecyl pentanoate?
The canonical SMILES for 14-methylpentadecyl pentanoate is CCCCC(=O)OCCCCCCCCCCCCCC(C)C.
What is the InChIKey of 14-methylpentadecyl pentanoate?
The InChIKey is AZBDOGMKZHPRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O2/c1-4-5-18-21(22)23-19-16-14-12-10-8-6-7-9-11-13-15-17-20(2)3/h20H,4-19H2,1-3H3.
What are the key properties of 14-methylpentadecyl pentanoate?
14-methylpentadecyl pentanoate has a molecular weight of 326.57 g/mol, XLogP of 7.06, 17 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14-methylpentadecyl pentanoate is sourced from PubChem (CID 157275601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).