C32H33NO4 — CID 157278603
3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 157278603) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 157278603 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 3-[(E)-4-[4-(1-adamantyl)phenoxy]-2-oxobut-3-enyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(/C=C/Oc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)Cc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C32H33NO4/c34-28(17-22-3-1-4-26(16-22)31(35)33-21-30-5-2-11-36-30)10-12-37-29-8-6-27(7-9-29)32-18-23-13-24(19-32)15-25(14-23)20-32/h1-12,16,23-25H,13-15,17-21H2,(H,33,35)/b12-10+ |
| InChIKey | AZJXNASYWWRICU-ZRDIBKRKSA-N |
| XLogP | 6.38 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|