C31H37N3 — CID 157282556
1-[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-naphthalen-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]triazole (PubChem CID 157282556) has the molecular formula C31H37N3 and a molecular weight of 451.66 g/mol. Its IUPAC name is 1-[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-naphthalen-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]triazole.
| Compound Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-naphthalen-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]triazole |
|---|---|
| PubChem CID | 157282556 |
| Molecular Formula | C31H37N3 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.30 |
| IUPAC Name | 1-[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-17-naphthalen-2-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]triazole |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](n5ccnn5)CC[C@@]43C)[C@@H]1CC[C@@H]2c1ccc2ccccc2c1 |
| InChI | InChI=1S/C31H37N3/c1-30-15-13-25(34-18-17-32-33-34)20-24(30)9-10-26-28-12-11-27(31(28,2)16-14-29(26)30)23-8-7-21-5-3-4-6-22(21)19-23/h3-9,17-19,25-29H,10-16,20H2,1-2H3/t25-,26-,27+,28-,29-,30-,31+/m0/s1 |
| InChIKey | QITVGVZRBNGGPT-GFBGSRHDSA-N |
| XLogP | 7.72 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|