C38H48O4 — CID 101068275
[(1R,2S)-2-naphthalen-2-ylcyclohexyl] (3S,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 101068275) has the molecular formula C38H48O4 and a molecular weight of 568.80 g/mol. Its IUPAC name is [(1R,2S)-2-naphthalen-2-ylcyclohexyl] (3S,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | [(1R,2S)-2-naphthalen-2-ylcyclohexyl] (3S,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 101068275 |
| Molecular Formula | C38H48O4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.36 |
| IUPAC Name | [(1R,2S)-2-naphthalen-2-ylcyclohexyl] (3S,8S,9S,10R,13S,14S,17S)-3-acetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H](C(=O)O[C@@H]5CCCC[C@H]5c5ccc6ccccc6c5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C38H48O4/c1-24(39)41-29-18-20-37(2)28(23-29)14-15-31-32-16-17-34(38(32,3)21-19-33(31)37)36(40)42-35-11-7-6-10-30(35)27-13-12-25-8-4-5-9-26(25)22-27/h4-5,8-9,12-14,22,29-35H,6-7,10-11,15-21,23H2,1-3H3/t29-,30-,31-,32-,33-,34+,35+,37-,38-/m0/s1 |
| InChIKey | GUEJBSNDLVMVIM-IRQQKRBWSA-N |
| XLogP | 8.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|