C24H26F2N2O — CID 157286545
3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-1,6,8,9-tetrahydrobenzo[f]indazol-5-one (PubChem CID 157286545) has the molecular formula C24H26F2N2O and a molecular weight of 396.48 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-1,6,8,9-tetrahydrobenzo[f]indazol-5-one.
| Compound Name | 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-1,6,8,9-tetrahydrobenzo[f]indazol-5-one |
|---|---|
| PubChem CID | 157286545 |
| Molecular Formula | C24H26F2N2O |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-1,6,8,9-tetrahydrobenzo[f]indazol-5-one |
| SMILES | CC1(C)CC(=O)C2=C(Cc3[nH]nc(C4CC(F)(F)C4)c3C2(C)c2ccccc2)C1 |
| InChI | InChI=1S/C24H26F2N2O/c1-22(2)10-14-9-17-20(21(28-27-17)15-11-24(25,26)12-15)23(3,19(14)18(29)13-22)16-7-5-4-6-8-16/h4-8,15H,9-13H2,1-3H3,(H,27,28) |
| InChIKey | WCMOMNRBOXPBSD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |