C34H30BN6O2 — CID 157286946
CID 157286946 (PubChem CID 157286946) has the molecular formula C34H30BN6O2 and a molecular weight of 565.47 g/mol.
| Compound Name | CID 157286946 |
|---|---|
| PubChem CID | 157286946 |
| Molecular Formula | C34H30BN6O2 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | — |
| SMILES | C=Cc1ccc(COc2ccc(-c3nc(N)nc(N)n3)cc2)cc1.C=Cc1ccc(COc2ccc(C#N)cc2)cc1.[B] |
| InChI | InChI=1S/C18H17N5O.C16H13NO.B/c1-2-12-3-5-13(6-4-12)11-24-15-9-7-14(8-10-15)16-21-17(19)23-18(20)22-16;1-2-13-3-5-15(6-4-13)12-18-16-9-7-14(11-17)8-10-16;/h2-10H,1,11H2,(H4,19,20,21,22,23);2-10H,1,12H2; |
| InChIKey | CCPNFAYIQJJUSK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|